C28H29N3O4 — CID 129138684
4-[(2S,3R,4R,5S,6R)-4-[2-(dimethylamino)ethyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129138684) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(2S,3R,4R,5S,6R)-4-[2-(dimethylamino)ethyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4R,5S,6R)-4-[2-(dimethylamino)ethyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138684 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[(2S,3R,4R,5S,6R)-4-[2-(dimethylamino)ethyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CCN(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C28H29N3O4/c1-31(2)14-13-21-24(19-7-5-4-6-8-19)28(20-11-9-18(15-29)10-12-20)27(33,26(21)32)25-22(34-3)16-30-17-23(25)35-28/h4-12,16-17,21,24,26,32-33H,13-14H2,1-3H3/t21-,24-,26-,27+,28+/m1/s1 |
| InChIKey | SVMMJISNDZYPMV-GBKKCVIMSA-N |
| XLogP | 3.16 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |