C24H20BrNO6 — CID 129138700
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10-methoxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid (PubChem CID 129138700) has the molecular formula C24H20BrNO6 and a molecular weight of 498.33 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10-methoxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10-methoxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 129138700 |
| Molecular Formula | C24H20BrNO6 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10-methoxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid |
| SMILES | COc1cnc2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)[C@@H](C(=O)O)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C24H20BrNO6/c1-31-16-11-17-20(26-12-16)23(30)21(27)18(22(28)29)19(13-5-3-2-4-6-13)24(23,32-17)14-7-9-15(25)10-8-14/h2-12,18-19,21,27,30H,1H3,(H,28,29)/t18-,19-,21-,23+,24+/m1/s1 |
| InChIKey | FCDXYZFNNKOKGX-CLODTNMZSA-N |
| XLogP | 3.19 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |