C27H26F2N2O5 — CID 129138751
6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129138751) has the molecular formula C27H26F2N2O5 and a molecular weight of 496.51 g/mol. Its IUPAC name is 6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | 6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138751 |
| Molecular Formula | C27H26F2N2O5 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1C1(O)C(O)C(C(=O)N(C)C)C(c3ccccc3)C1(c1ccc(C(F)F)cc1)O2 |
| InChI | InChI=1S/C27H26F2N2O5/c1-31(2)25(33)20-21(15-7-5-4-6-8-15)27(17-11-9-16(10-12-17)24(28)29)26(34,23(20)32)22-18(35-3)13-30-14-19(22)36-27/h4-14,20-21,23-24,32,34H,1-3H3 |
| InChIKey | HLHHGIYRTDPYDH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |