C23H16BrClN2O3 — CID 129138759
(2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carbonitrile (PubChem CID 129138759) has the molecular formula C23H16BrClN2O3 and a molecular weight of 483.75 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carbonitrile.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carbonitrile |
|---|---|
| PubChem CID | 129138759 |
| Molecular Formula | C23H16BrClN2O3 |
| Molecular Weight | 483.75 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carbonitrile |
| SMILES | N#C[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H16BrClN2O3/c24-15-8-6-14(7-9-15)23-19(13-4-2-1-3-5-13)17(11-26)21(28)22(23,29)20-18(30-23)10-16(25)12-27-20/h1-10,12,17,19,21,28-29H/t17-,19-,21-,22+,23+/m1/s1 |
| InChIKey | JVLQRLUTZDUOTC-VXOHKJIOSA-N |
| XLogP | 4.27 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.75 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |