C25H22Cl2N2O4 — CID 129138774
(2S,3R,4R,5S,6R)-10-chloro-6-(4-chlorophenyl)-2,3-dihydroxy-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide (PubChem CID 129138774) has the molecular formula C25H22Cl2N2O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-10-chloro-6-(4-chlorophenyl)-2,3-dihydroxy-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-10-chloro-6-(4-chlorophenyl)-2,3-dihydroxy-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138774 |
| Molecular Formula | C25H22Cl2N2O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-10-chloro-6-(4-chlorophenyl)-2,3-dihydroxy-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(Cl)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H22Cl2N2O4/c1-29(2)23(31)19-20(14-6-4-3-5-7-14)25(15-8-10-16(26)11-9-15)24(32,22(19)30)21-18(33-25)12-17(27)13-28-21/h3-13,19-20,22,30,32H,1-2H3/t19-,20-,22-,24+,25+/m1/s1 |
| InChIKey | WZKWYJTUICLDSJ-ZACHVALMSA-N |
| XLogP | 3.73 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |