C28H31BrN2O4 — CID 129138828
(2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-(diethylaminomethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 129138828) has the molecular formula C28H31BrN2O4 and a molecular weight of 539.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-(diethylaminomethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-(diethylaminomethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 129138828 |
| Molecular Formula | C28H31BrN2O4 |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-(diethylaminomethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | CCN(CC)C[C@H]1[C@@H](O)[C@@]2(O)c3c(OC)cncc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H31BrN2O4/c1-4-31(5-2)17-21-24(18-9-7-6-8-10-18)28(19-11-13-20(29)14-12-19)27(33,26(21)32)25-22(34-3)15-30-16-23(25)35-28/h6-16,21,24,26,32-33H,4-5,17H2,1-3H3/t21-,24-,26-,27+,28+/m1/s1 |
| InChIKey | GFTKZAQTIVYFEJ-GBKKCVIMSA-N |
| XLogP | 4.44 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |