C25H25BrN2O4 — CID 129138871
(2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol (PubChem CID 129138871) has the molecular formula C25H25BrN2O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol.
| Compound Name | (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
|---|---|
| PubChem CID | 129138871 |
| Molecular Formula | C25H25BrN2O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
| SMILES | COc1cncc2c1[C@]1(O)[C@@H](CN)[C@H](CO)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C25H25BrN2O4/c1-31-20-12-28-13-21-23(20)24(30)19(11-27)18(14-29)22(15-5-3-2-4-6-15)25(24,32-21)16-7-9-17(26)10-8-16/h2-10,12-13,18-19,22,29-30H,11,14,27H2,1H3/t18-,19-,22+,24+,25-/m0/s1 |
| InChIKey | KDWZKFZPGWZUHU-UPIYQZMDSA-N |
| XLogP | 3.31 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |