C30H26BrClN2O5S — CID 129138882
(2S,3S,4R,5S,6R)-N-benzyl-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide (PubChem CID 129138882) has the molecular formula C30H26BrClN2O5S and a molecular weight of 641.97 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-N-benzyl-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide.
| Compound Name | (2S,3S,4R,5S,6R)-N-benzyl-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
|---|---|
| PubChem CID | 129138882 |
| Molecular Formula | C30H26BrClN2O5S |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 640.04 |
| IUPAC Name | (2S,3S,4R,5S,6R)-N-benzyl-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-N-methyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H26BrClN2O5S/c1-34(18-19-8-4-2-5-9-19)40(37,38)26-25(20-10-6-3-7-11-20)30(21-12-14-22(31)15-13-21)29(36,28(26)35)27-24(39-30)16-23(32)17-33-27/h2-17,25-26,28,35-36H,18H2,1H3/t25-,26-,28-,29+,30+/m1/s1 |
| InChIKey | RJHVNMNXQHUDJQ-CYRRNJDUSA-N |
| XLogP | 4.96 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |