C27H26BrF3N2O4 — CID 129138899
6-(4-bromophenyl)-12-methoxy-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 129138899) has the molecular formula C27H26BrF3N2O4 and a molecular weight of 579.41 g/mol. Its IUPAC name is 6-(4-bromophenyl)-12-methoxy-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | 6-(4-bromophenyl)-12-methoxy-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 129138899 |
| Molecular Formula | C27H26BrF3N2O4 |
| Molecular Weight | 579.41 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 6-(4-bromophenyl)-12-methoxy-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | COc1cncc2c1C1(O)C(O)C(CN(C)CC(F)(F)F)C(c3ccccc3)C1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C27H26BrF3N2O4/c1-33(15-25(29,30)31)14-19-22(16-6-4-3-5-7-16)27(17-8-10-18(28)11-9-17)26(35,24(19)34)23-20(36-2)12-32-13-21(23)37-27/h3-13,19,22,24,34-35H,14-15H2,1-2H3 |
| InChIKey | CRQYIEUQKRKHLM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |