C22H15BrClF2NO4 — CID 129138923
6-(4-bromophenyl)-10-chloro-4,4-difluoro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3,3-triol (PubChem CID 129138923) has the molecular formula C22H15BrClF2NO4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 6-(4-bromophenyl)-10-chloro-4,4-difluoro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3,3-triol.
| Compound Name | 6-(4-bromophenyl)-10-chloro-4,4-difluoro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3,3-triol |
|---|---|
| PubChem CID | 129138923 |
| Molecular Formula | C22H15BrClF2NO4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 508.98 |
| IUPAC Name | 6-(4-bromophenyl)-10-chloro-4,4-difluoro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3,3-triol |
| SMILES | OC1(O)C(F)(F)C(c2ccccc2)C2(c3ccc(Br)cc3)Oc3cc(Cl)cnc3C21O |
| InChI | InChI=1S/C22H15BrClF2NO4/c23-14-8-6-13(7-9-14)19-17(12-4-2-1-3-5-12)21(25,26)22(29,30)20(19,28)18-16(31-19)10-15(24)11-27-18/h1-11,17,28-30H |
| InChIKey | PITIPSPNJSLOOD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|