C27H20BrClN2O3S — CID 129138947
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-5-phenyl-4-pyridin-2-ylsulfanyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol (PubChem CID 129138947) has the molecular formula C27H20BrClN2O3S and a molecular weight of 567.89 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-5-phenyl-4-pyridin-2-ylsulfanyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-5-phenyl-4-pyridin-2-ylsulfanyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
|---|---|
| PubChem CID | 129138947 |
| Molecular Formula | C27H20BrClN2O3S |
| Molecular Weight | 567.89 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-5-phenyl-4-pyridin-2-ylsulfanyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
| SMILES | O[C@H]1[C@H](Sc2ccccn2)[C@@H](c2ccccc2)[C@]2(c3ccc(Br)cc3)Oc3cc(Cl)cnc3[C@]12O |
| InChI | InChI=1S/C27H20BrClN2O3S/c28-18-11-9-17(10-12-18)27-22(16-6-2-1-3-7-16)23(35-21-8-4-5-13-30-21)25(32)26(27,33)24-20(34-27)14-19(29)15-31-24/h1-15,22-23,25,32-33H/t22-,23-,25+,26+,27+/m1/s1 |
| InChIKey | UOCRDLLDYGPTMB-PBWOLCSJSA-N |
| XLogP | 5.69 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |