C24H19ClN2O5S — CID 129138982
4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile (PubChem CID 129138982) has the molecular formula C24H19ClN2O5S and a molecular weight of 482.95 g/mol. Its IUPAC name is 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138982 |
| Molecular Formula | C24H19ClN2O5S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 4-[(2S,3S,4R,5S,6R)-10-chloro-2,3-dihydroxy-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
| SMILES | CS(=O)(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(C#N)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O5S/c1-33(30,31)20-19(15-5-3-2-4-6-15)24(16-9-7-14(12-26)8-10-16)23(29,22(20)28)21-18(32-24)11-17(25)13-27-21/h2-11,13,19-20,22,28-29H,1H3/t19-,20-,22-,23+,24+/m1/s1 |
| InChIKey | KXCNDQQWXQYPFV-VEEZHQPXSA-N |
| XLogP | 2.65 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |