C29H31BrN2O5 — CID 129138986
(2R,3R,4R,5S,6R)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-3-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol (PubChem CID 129138986) has the molecular formula C29H31BrN2O5 and a molecular weight of 567.48 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-3-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol.
| Compound Name | (2R,3R,4R,5S,6R)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-3-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
|---|---|
| PubChem CID | 129138986 |
| Molecular Formula | C29H31BrN2O5 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-(4-bromophenyl)-4-(hydroxymethyl)-12-methoxy-3-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
| SMILES | COc1cncc2c1[C@]1(O)[C@@H](CN3CCOCC3)[C@H](CO)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C29H31BrN2O5/c1-35-24-15-31-16-25-27(24)28(34)23(17-32-11-13-36-14-12-32)22(18-33)26(19-5-3-2-4-6-19)29(28,37-25)20-7-9-21(30)10-8-20/h2-10,15-16,22-23,26,33-34H,11-14,17-18H2,1H3/t22-,23-,26+,28+,29-/m0/s1 |
| InChIKey | IFRZKYZIXROIRF-PUOQHSKASA-N |
| XLogP | 3.68 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |