C12H25N — CID 129138997
(5,5-dimethylcyclononyl)methanamine (PubChem CID 129138997) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (5,5-dimethylcyclononyl)methanamine.
| Compound Name | (5,5-dimethylcyclononyl)methanamine |
|---|---|
| PubChem CID | 129138997 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (5,5-dimethylcyclononyl)methanamine |
| SMILES | CC1(C)CCCCC(CN)CCC1 |
| InChI | InChI=1S/C12H25N/c1-12(2)8-4-3-6-11(10-13)7-5-9-12/h11H,3-10,13H2,1-2H3 |
| InChIKey | NYNCNEIGXSTGPA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |