C27H29BrN2O5 — CID 129139092
(2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(dimethylamino)methyl]-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 129139092) has the molecular formula C27H29BrN2O5 and a molecular weight of 541.44 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(dimethylamino)methyl]-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(dimethylamino)methyl]-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 129139092 |
| Molecular Formula | C27H29BrN2O5 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-4-[(dimethylamino)methyl]-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | COc1cc2c(c(OC)n1)[C@]1(O)[C@H](O)[C@H](CN(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C27H29BrN2O5/c1-30(2)15-19-22(16-8-6-5-7-9-16)27(17-10-12-18(28)13-11-17)26(32,24(19)31)23-20(35-27)14-21(33-3)29-25(23)34-4/h5-14,19,22,24,31-32H,15H2,1-4H3/t19-,22-,24-,26+,27+/m1/s1 |
| InChIKey | SGMUBPQVEXPFJY-IVMYZHNFSA-N |
| XLogP | 3.67 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |