C25H22ClN3O4 — CID 129139117
4-[(2S,3R,4S,5S,6R)-4-(aminomethyl)-10-chloro-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129139117) has the molecular formula C25H22ClN3O4 and a molecular weight of 463.92 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-4-(aminomethyl)-10-chloro-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-4-(aminomethyl)-10-chloro-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129139117 |
| Molecular Formula | C25H22ClN3O4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-4-(aminomethyl)-10-chloro-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1nc(Cl)cc2c1[C@]1(O)[C@H](O)[C@H](CN)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C25H22ClN3O4/c1-32-23-21-18(11-19(26)29-23)33-25(16-9-7-14(12-27)8-10-16)20(15-5-3-2-4-6-15)17(13-28)22(30)24(21,25)31/h2-11,17,20,22,30-31H,13,28H2,1H3/t17-,20-,22-,24+,25+/m1/s1 |
| InChIKey | JSGLTNDLFBFZFN-UUZKZGARSA-N |
| XLogP | 2.82 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|