C26H22BrF3N2O5 — CID 129139179
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-N-(2,2,2-trifluoroethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129139179) has the molecular formula C26H22BrF3N2O5 and a molecular weight of 579.37 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-N-(2,2,2-trifluoroethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-N-(2,2,2-trifluoroethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129139179 |
| Molecular Formula | C26H22BrF3N2O5 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-N-(2,2,2-trifluoroethyl)-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(=O)NCC(F)(F)F)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C26H22BrF3N2O5/c1-36-17-11-31-12-18-21(17)25(35)22(33)19(23(34)32-13-24(28,29)30)20(14-5-3-2-4-6-14)26(25,37-18)15-7-9-16(27)10-8-15/h2-12,19-20,22,33,35H,13H2,1H3,(H,32,34)/t19-,20-,22-,25+,26+/m1/s1 |
| InChIKey | ZRYGVDXVESVLDP-YHVMUTAASA-N |
| XLogP | 3.78 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |