C24H19ClN2O4 — CID 129139250
4-[(2S,3R,4S,5S,6R)-10-chloro-2,3-dihydroxy-4-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile (PubChem CID 129139250) has the molecular formula C24H19ClN2O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-10-chloro-2,3-dihydroxy-4-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-10-chloro-2,3-dihydroxy-4-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129139250 |
| Molecular Formula | C24H19ClN2O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-10-chloro-2,3-dihydroxy-4-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@H](O)[C@H](CO)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19ClN2O4/c25-17-10-19-21(27-12-17)23(30)22(29)18(13-28)20(15-4-2-1-3-5-15)24(23,31-19)16-8-6-14(11-26)7-9-16/h1-10,12,18,20,22,28-30H,13H2/t18-,20-,22-,23+,24+/m1/s1 |
| InChIKey | FXDLRRSTFWBPBL-GRAZHTGVSA-N |
| XLogP | 2.85 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |