C29H23BrClNO5S — CID 129139304
(2S,3S,4R,5S,6R)-4-benzylsulfonyl-6-(4-bromophenyl)-10-chloro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol (PubChem CID 129139304) has the molecular formula C29H23BrClNO5S and a molecular weight of 612.93 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-4-benzylsulfonyl-6-(4-bromophenyl)-10-chloro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol.
| Compound Name | (2S,3S,4R,5S,6R)-4-benzylsulfonyl-6-(4-bromophenyl)-10-chloro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
|---|---|
| PubChem CID | 129139304 |
| Molecular Formula | C29H23BrClNO5S |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 611.02 |
| IUPAC Name | (2S,3S,4R,5S,6R)-4-benzylsulfonyl-6-(4-bromophenyl)-10-chloro-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
| SMILES | O=S(=O)(Cc1ccccc1)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H23BrClNO5S/c30-21-13-11-20(12-14-21)29-24(19-9-5-2-6-10-19)25(38(35,36)17-18-7-3-1-4-8-18)27(33)28(29,34)26-23(37-29)15-22(31)16-32-26/h1-16,24-25,27,33-34H,17H2/t24-,25-,27-,28+,29+/m1/s1 |
| InChIKey | CZROKGQBYTYDHX-GNKDQBBKSA-N |
| XLogP | 5.11 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |