C23H19BrClNO5S — CID 129139321
(2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol (PubChem CID 129139321) has the molecular formula C23H19BrClNO5S and a molecular weight of 536.83 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol.
| Compound Name | (2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
|---|---|
| PubChem CID | 129139321 |
| Molecular Formula | C23H19BrClNO5S |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | (2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-4-methylsulfonyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-2,3-diol |
| SMILES | CS(=O)(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ncc(Cl)cc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H19BrClNO5S/c1-32(29,30)19-18(13-5-3-2-4-6-13)23(14-7-9-15(24)10-8-14)22(28,21(19)27)20-17(31-23)11-16(25)12-26-20/h2-12,18-19,21,27-28H,1H3/t18-,19-,21-,22+,23+/m1/s1 |
| InChIKey | HPVGRQOGDMSMHO-RVPFZPFESA-N |
| XLogP | 3.54 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |