C32H29N3O4 — CID 129139323
4-[(2S,3R,4S,5S,6R)-4-[(benzylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129139323) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-4-[(benzylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-4-[(benzylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129139323 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-4-[(benzylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CNCc3ccccc3)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C32H29N3O4/c1-38-26-19-35-20-27-29(26)31(37)30(36)25(18-34-17-22-8-4-2-5-9-22)28(23-10-6-3-7-11-23)32(31,39-27)24-14-12-21(16-33)13-15-24/h2-15,19-20,25,28,30,34,36-37H,17-18H2,1H3/t25-,28-,30-,31+,32+/m1/s1 |
| InChIKey | JEZJLHYFGBKEQQ-PZJSGBQRSA-N |
| XLogP | 4.00 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |