C27H25N3O5 — CID 129139368
(2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129139368) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129139368 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(=O)N(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C27H25N3O5/c1-30(2)25(32)21-22(17-7-5-4-6-8-17)27(18-11-9-16(13-28)10-12-18)26(33,24(21)31)23-19(34-3)14-29-15-20(23)35-27/h4-12,14-15,21-22,24,31,33H,1-3H3/t21-,22-,24-,26+,27+/m1/s1 |
| InChIKey | SDIUVKKXAGVAIO-PXIJUOARSA-N |
| XLogP | 2.30 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |