About 3,4-dihydro-1H-isochromene-5,8-dione
3,4-dihydro-1H-isochromene-5,8-dione (PubChem CID 12913941) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromene-5,8-dione.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-isochromene-5,8-dione |
| PubChem CID | 12913941 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 3,4-dihydro-1H-isochromene-5,8-dione |
| SMILES | O=C1C=CC(=O)C2=C1CCOC2 |
| InChI | InChI=1S/C9H8O3/c10-8-1-2-9(11)7-5-12-4-3-6(7)8/h1-2H,3-5H2 |
| InChIKey | DGJQWDOLPJWEGM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-1H-isochromene-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-isochromene-5,8-dione?
The IUPAC name of 3,4-dihydro-1H-isochromene-5,8-dione (CID 12913941) is 3,4-dihydro-1H-isochromene-5,8-dione.
What is the SMILES notation for 3,4-dihydro-1H-isochromene-5,8-dione?
The canonical SMILES for 3,4-dihydro-1H-isochromene-5,8-dione is O=C1C=CC(=O)C2=C1CCOC2.
What is the InChIKey of 3,4-dihydro-1H-isochromene-5,8-dione?
The InChIKey is DGJQWDOLPJWEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-8-1-2-9(11)7-5-12-4-3-6(7)8/h1-2H,3-5H2.
What are the key properties of 3,4-dihydro-1H-isochromene-5,8-dione?
3,4-dihydro-1H-isochromene-5,8-dione has a molecular weight of 164.16 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-isochromene-5,8-dione is sourced from PubChem (CID 12913941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).