About 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione
1-methyl-3,4-dihydro-1H-isochromene-5,8-dione (PubChem CID 12913942) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione.
Molecular Properties
| Compound Name | 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
| PubChem CID | 12913942 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
| SMILES | CC1OCCC2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C10H10O3/c1-6-10-7(4-5-13-6)8(11)2-3-9(10)12/h2-3,6H,4-5H2,1H3 |
| InChIKey | HMSAWMLLYUGVBO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione?
The IUPAC name of 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione (CID 12913942) is 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione.
What is the SMILES notation for 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione?
The canonical SMILES for 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione is CC1OCCC2=C1C(=O)C=CC2=O.
What is the InChIKey of 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione?
The InChIKey is HMSAWMLLYUGVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-6-10-7(4-5-13-6)8(11)2-3-9(10)12/h2-3,6H,4-5H2,1H3.
What are the key properties of 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione?
1-methyl-3,4-dihydro-1H-isochromene-5,8-dione has a molecular weight of 178.19 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4-dihydro-1H-isochromene-5,8-dione is sourced from PubChem (CID 12913942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).