About 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole (PubChem CID 129139590) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole |
| PubChem CID | 129139590 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(C2CCC3(CC2)OCCO3)n1 |
| InChI | InChI=1S/C13H20N2O2/c1-10-9-11(2)15(14-10)12-3-5-13(6-4-12)16-7-8-17-13/h9,12H,3-8H2,1-2H3 |
| InChIKey | JDEXIRYFXMAYDY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole?
The IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole (CID 129139590) is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole.
What is the SMILES notation for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole?
The canonical SMILES for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole is Cc1cc(C)n(C2CCC3(CC2)OCCO3)n1.
What is the InChIKey of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole?
The InChIKey is JDEXIRYFXMAYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-10-9-11(2)15(14-10)12-3-5-13(6-4-12)16-7-8-17-13/h9,12H,3-8H2,1-2H3.
What are the key properties of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole?
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole has a molecular weight of 236.31 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,5-dimethylpyrazole is sourced from PubChem (CID 129139590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).