About 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine
2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine (PubChem CID 12913974) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine.
Molecular Properties
| Compound Name | 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine |
| PubChem CID | 12913974 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine |
| SMILES | CCc1ncn2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C13H12N4/c1-2-12-14-9-17-13(15-12)8-11(16-17)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | LSFLROHHYQOPFL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine?
The IUPAC name of 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine (CID 12913974) is 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine.
What is the SMILES notation for 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine?
The canonical SMILES for 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine is CCc1ncn2nc(-c3ccccc3)cc2n1.
What is the InChIKey of 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine?
The InChIKey is LSFLROHHYQOPFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c1-2-12-14-9-17-13(15-12)8-11(16-17)10-6-4-3-5-7-10/h3-9H,2H2,1H3.
What are the key properties of 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine?
2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine has a molecular weight of 224.27 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-phenylpyrazolo[1,5-a][1,3,5]triazine is sourced from PubChem (CID 12913974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).