About ethyl 4-benzamidobenzoate
ethyl 4-benzamidobenzoate (PubChem CID 12914) has the molecular formula C16H15NO3
and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 4-benzamidobenzoate.
Molecular Properties
| Compound Name | ethyl 4-benzamidobenzoate |
| PubChem CID | 12914 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | ethyl 4-benzamidobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-2-20-16(19)13-8-10-14(11-9-13)17-15(18)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H,17,18) |
| InChIKey | XFPYCMXNXPPZRV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-benzamidobenzoate?
The IUPAC name of ethyl 4-benzamidobenzoate (CID 12914) is ethyl 4-benzamidobenzoate.
What is the SMILES notation for ethyl 4-benzamidobenzoate?
The canonical SMILES for ethyl 4-benzamidobenzoate is CCOC(=O)c1ccc(NC(=O)c2ccccc2)cc1.
What is the InChIKey of ethyl 4-benzamidobenzoate?
The InChIKey is XFPYCMXNXPPZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3/c1-2-20-16(19)13-8-10-14(11-9-13)17-15(18)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H,17,18).
What are the key properties of ethyl 4-benzamidobenzoate?
ethyl 4-benzamidobenzoate has a molecular weight of 269.30 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-benzamidobenzoate is sourced from PubChem (CID 12914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).