C17H19F3N4O6S2 — CID 129140452
2,2,2-trifluoro-N-[3-[4-formamido-1-[(2R,4R,5R)-5-(hydroxymethyl)-4-[(methyldisulfanyl)methoxy]oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynyl]acetamide (PubChem CID 129140452) has the molecular formula C17H19F3N4O6S2 and a molecular weight of 496.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[4-formamido-1-[(2R,4R,5R)-5-(hydroxymethyl)-4-[(methyldisulfanyl)methoxy]oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[4-formamido-1-[(2R,4R,5R)-5-(hydroxymethyl)-4-[(methyldisulfanyl)methoxy]oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 129140452 |
| Molecular Formula | C17H19F3N4O6S2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[4-formamido-1-[(2R,4R,5R)-5-(hydroxymethyl)-4-[(methyldisulfanyl)methoxy]oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-ynyl]acetamide |
| SMILES | CSSCO[C@@H]1C[C@H](n2cc(C#CCNC(=O)C(F)(F)F)c(NC=O)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C17H19F3N4O6S2/c1-31-32-9-29-11-5-13(30-12(11)7-25)24-6-10(14(22-8-26)23-16(24)28)3-2-4-21-15(27)17(18,19)20/h6,8,11-13,25H,4-5,7,9H2,1H3,(H,21,27)(H,22,23,26,28)/t11-,12-,13-/m1/s1 |
| InChIKey | ZWKHZYXMHRFBLS-JHJVBQTASA-N |
| XLogP | 0.48 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|