C9H6F6 — CID 129140578
(3Z,5E)-8,8,8-trifluoro-5-(trifluoromethyl)octa-3,5-dien-1-yne (PubChem CID 129140578) has the molecular formula C9H6F6 and a molecular weight of 228.14 g/mol. Its IUPAC name is (3Z,5E)-8,8,8-trifluoro-5-(trifluoromethyl)octa-3,5-dien-1-yne.
| Compound Name | (3Z,5E)-8,8,8-trifluoro-5-(trifluoromethyl)octa-3,5-dien-1-yne |
|---|---|
| PubChem CID | 129140578 |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (3Z,5E)-8,8,8-trifluoro-5-(trifluoromethyl)octa-3,5-dien-1-yne |
| SMILES | C#C/C=C\C(=C/CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F6/c1-2-3-4-7(9(13,14)15)5-6-8(10,11)12/h1,3-5H,6H2/b4-3-,7-5+ |
| InChIKey | RJPJNKQCQVBJHN-QVXLNCAUSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|