C15H22N2OS — CID 129140731
4-(4,5,6-trimethyl-4H-thiopyran-3-yl)cyclohex-3-ene-1-carbohydrazide (PubChem CID 129140731) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-(4,5,6-trimethyl-4H-thiopyran-3-yl)cyclohex-3-ene-1-carbohydrazide.
| Compound Name | 4-(4,5,6-trimethyl-4H-thiopyran-3-yl)cyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 129140731 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-(4,5,6-trimethyl-4H-thiopyran-3-yl)cyclohex-3-ene-1-carbohydrazide |
| SMILES | CC1=C(C)C(C)C(C2=CCC(C(=O)NN)CC2)=CS1 |
| InChI | InChI=1S/C15H22N2OS/c1-9-10(2)14(8-19-11(9)3)12-4-6-13(7-5-12)15(18)17-16/h4,8,10,13H,5-7,16H2,1-3H3,(H,17,18) |
| InChIKey | JOBVIGBPHNDCJM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|