C24H36N4O2 — CID 129141346
[(4R)-2,2-diethyl-4-methoxypyrrolidin-1-yl]-[(5R)-7,7-dimethyl-5-phenyl-2,4,5,6-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 129141346) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is [(4R)-2,2-diethyl-4-methoxypyrrolidin-1-yl]-[(5R)-7,7-dimethyl-5-phenyl-2,4,5,6-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | [(4R)-2,2-diethyl-4-methoxypyrrolidin-1-yl]-[(5R)-7,7-dimethyl-5-phenyl-2,4,5,6-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 129141346 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(4R)-2,2-diethyl-4-methoxypyrrolidin-1-yl]-[(5R)-7,7-dimethyl-5-phenyl-2,4,5,6-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | CCC1(CC)C[C@@H](OC)CN1C(=O)C1=C2N[C@@H](c3ccccc3)CC(C)(C)N2NC1 |
| InChI | InChI=1S/C24H36N4O2/c1-6-24(7-2)13-18(30-5)16-27(24)22(29)19-15-25-28-21(19)26-20(14-23(28,3)4)17-11-9-8-10-12-17/h8-12,18,20,25-26H,6-7,13-16H2,1-5H3/t18-,20-/m1/s1 |
| InChIKey | FVKXNUQYYAQXDA-UYAOXDASSA-N |
| XLogP | 3.34 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |