C14H24N2O3 — CID 129141607
methyl 2-(3,3,5,5-tetramethyl-4-prop-2-enoylpiperazin-1-yl)acetate (PubChem CID 129141607) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 2-(3,3,5,5-tetramethyl-4-prop-2-enoylpiperazin-1-yl)acetate.
| Compound Name | methyl 2-(3,3,5,5-tetramethyl-4-prop-2-enoylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 129141607 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | methyl 2-(3,3,5,5-tetramethyl-4-prop-2-enoylpiperazin-1-yl)acetate |
| SMILES | C=CC(=O)N1C(C)(C)CN(CC(=O)OC)CC1(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-7-11(17)16-13(2,3)9-15(8-12(18)19-6)10-14(16,4)5/h7H,1,8-10H2,2-6H3 |
| InChIKey | ULGREXZEHZCPTH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|