C28H24Cl2N2O7S — CID 129141687
(2S)-2-[[5,7-dichloro-2-[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-sulfinophenyl)propanoic acid (PubChem CID 129141687) has the molecular formula C28H24Cl2N2O7S and a molecular weight of 603.48 g/mol. Its IUPAC name is (2S)-2-[[5,7-dichloro-2-[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-sulfinophenyl)propanoic acid.
| Compound Name | (2S)-2-[[5,7-dichloro-2-[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-sulfinophenyl)propanoic acid |
|---|---|
| PubChem CID | 129141687 |
| Molecular Formula | C28H24Cl2N2O7S |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (2S)-2-[[5,7-dichloro-2-[(E)-3-(2-hydroxyphenyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-sulfinophenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1cccc(S(=O)O)c1)C(=O)O)c1c(Cl)cc2c(c1Cl)CCN(C(=O)/C=C/c1ccccc1O)C2 |
| InChI | InChI=1S/C28H24Cl2N2O7S/c29-21-14-18-15-32(24(34)9-8-17-5-1-2-7-23(17)33)11-10-20(18)26(30)25(21)27(35)31-22(28(36)37)13-16-4-3-6-19(12-16)40(38)39/h1-9,12,14,22,33H,10-11,13,15H2,(H,31,35)(H,36,37)(H,38,39)/b9-8+/t22-/m0/s1 |
| InChIKey | RBSQNDGOQZCWGS-UVIRAJKCSA-N |
| XLogP | 4.30 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|