C53H36N4O — CID 129142382
2-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-phenylindeno[1,2-a]carbazol-7-yl]phenol (PubChem CID 129142382) has the molecular formula C53H36N4O and a molecular weight of 744.90 g/mol. Its IUPAC name is 2-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-phenylindeno[1,2-a]carbazol-7-yl]phenol.
| Compound Name | 2-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-phenylindeno[1,2-a]carbazol-7-yl]phenol |
|---|---|
| PubChem CID | 129142382 |
| Molecular Formula | C53H36N4O |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | 2-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-phenylindeno[1,2-a]carbazol-7-yl]phenol |
| SMILES | C#C/C=C\C=C/CC1(c2ccccc2O)c2ccccc2-c2c1ccc1c3cc(-c4ccccc4)ccc3n(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c21 |
| InChI | InChI=1S/C53H36N4O/c1-2-3-4-5-19-34-53(44-28-17-18-29-47(44)58)43-27-16-15-26-41(43)48-45(53)32-31-40-42-35-39(36-20-9-6-10-21-36)30-33-46(42)57(49(40)48)52-55-50(37-22-11-7-12-23-37)54-51(56-52)38-24-13-8-14-25-38/h1,3-33,35,58H,34H2/b4-3-,19-5- |
| InChIKey | HGNOGMRSJHNSTC-OIMQZHSHSA-N |
| XLogP | 12.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|