C28H45Cl — CID 129142433
(3E,5E,7Z,9E,11E)-2-chloro-3,4,5,6,7,8,9,10,12-nonamethyl-11-(2-methylbutan-2-yl)tetradeca-1,3,5,7,9,11-hexaene (PubChem CID 129142433) has the molecular formula C28H45Cl and a molecular weight of 417.12 g/mol. Its IUPAC name is (3E,5E,7Z,9E,11E)-2-chloro-3,4,5,6,7,8,9,10,12-nonamethyl-11-(2-methylbutan-2-yl)tetradeca-1,3,5,7,9,11-hexaene.
| Compound Name | (3E,5E,7Z,9E,11E)-2-chloro-3,4,5,6,7,8,9,10,12-nonamethyl-11-(2-methylbutan-2-yl)tetradeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 129142433 |
| Molecular Formula | C28H45Cl |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | (3E,5E,7Z,9E,11E)-2-chloro-3,4,5,6,7,8,9,10,12-nonamethyl-11-(2-methylbutan-2-yl)tetradeca-1,3,5,7,9,11-hexaene |
| SMILES | C=C(Cl)/C(C)=C(C)/C(C)=C(C)/C(C)=C(C)\C(C)=C(C)\C(=C(/C)CC)C(C)(C)CC |
| InChI | InChI=1S/C28H45Cl/c1-15-17(3)27(28(13,14)16-2)25(11)23(9)21(7)19(5)18(4)20(6)22(8)24(10)26(12)29/h12,15-16H2,1-11,13-14H3/b20-18+,21-19-,24-22+,25-23+,27-17- |
| InChIKey | ZDFDYXNQIMFNSV-LJLZDIQESA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|