About tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate
tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate (PubChem CID 129142897) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate |
| PubChem CID | 129142897 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOC1=CCC(N)C=C1 |
| InChI | InChI=1S/C15H26N2O3/c1-15(2,3)20-14(18)17-10-4-5-11-19-13-8-6-12(16)7-9-13/h6,8-9,12H,4-5,7,10-11,16H2,1-3H3,(H,17,18) |
| InChIKey | COFYMHYPPMIYQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate?
The IUPAC name of tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate (CID 129142897) is tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate?
The canonical SMILES for tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate is CC(C)(C)OC(=O)NCCCCOC1=CCC(N)C=C1.
What is the InChIKey of tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate?
The InChIKey is COFYMHYPPMIYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-15(2,3)20-14(18)17-10-4-5-11-19-13-8-6-12(16)7-9-13/h6,8-9,12H,4-5,7,10-11,16H2,1-3H3,(H,17,18).
What are the key properties of tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate?
tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate has a molecular weight of 282.38 g/mol, XLogP of 2.48, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(4-aminocyclohexa-1,5-dien-1-yl)oxybutyl]carbamate is sourced from PubChem (CID 129142897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).