C16H31N — CID 129143347
7,7-diethyl-N,2,4-trimethylnon-1-en-5-imine (PubChem CID 129143347) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 7,7-diethyl-N,2,4-trimethylnon-1-en-5-imine.
| Compound Name | 7,7-diethyl-N,2,4-trimethylnon-1-en-5-imine |
|---|---|
| PubChem CID | 129143347 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 7,7-diethyl-N,2,4-trimethylnon-1-en-5-imine |
| SMILES | C=C(C)CC(C)/C(CC(CC)(CC)CC)=N\C |
| InChI | InChI=1S/C16H31N/c1-8-16(9-2,10-3)12-15(17-7)14(6)11-13(4)5/h14H,4,8-12H2,1-3,5-7H3/b17-15- |
| InChIKey | ZSACBDWOPNKRBA-ICFOKQHNSA-N |
| XLogP | 5.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|