C25H30N4O — CID 129143819
(8E,14E)-8-[(Z)-but-1-enyl]-17-methyl-10-methylidene-11-oxa-2,4,17,24-tetrazatricyclo[17.3.1.13,7]tetracosa-1(22),3,5,7(24),8,14,19(23),20-octaene (PubChem CID 129143819) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is (8E,14E)-8-[(Z)-but-1-enyl]-17-methyl-10-methylidene-11-oxa-2,4,17,24-tetrazatricyclo[17.3.1.13,7]tetracosa-1(22),3,5,7(24),8,14,19(23),20-octaene.
| Compound Name | (8E,14E)-8-[(Z)-but-1-enyl]-17-methyl-10-methylidene-11-oxa-2,4,17,24-tetrazatricyclo[17.3.1.13,7]tetracosa-1(22),3,5,7(24),8,14,19(23),20-octaene |
|---|---|
| PubChem CID | 129143819 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (8E,14E)-8-[(Z)-but-1-enyl]-17-methyl-10-methylidene-11-oxa-2,4,17,24-tetrazatricyclo[17.3.1.13,7]tetracosa-1(22),3,5,7(24),8,14,19(23),20-octaene |
| SMILES | C=C1/C=C(\C=C/CC)c2ccnc(n2)Nc2cccc(c2)CN(C)C/C=C/CCO1 |
| InChI | InChI=1S/C25H30N4O/c1-4-5-11-22-17-20(2)30-16-8-6-7-15-29(3)19-21-10-9-12-23(18-21)27-25-26-14-13-24(22)28-25/h5-7,9-14,17-18H,2,4,8,15-16,19H2,1,3H3,(H,26,27,28)/b7-6+,11-5-,22-17+ |
| InChIKey | UOWPMERYTLQEIJ-GQGDJALXSA-N |
| XLogP | 5.49 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|