About ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate
ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate (PubChem CID 129143870) has the molecular formula C13H15F2NO4
and a molecular weight of 287.26 g/mol. Its IUPAC name is ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate.
Molecular Properties
| Compound Name | ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate |
| PubChem CID | 129143870 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate |
| SMILES | C=C(C/C(C(=C)F)=C(F)/C=C\C[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C13H15F2NO4/c1-4-20-13(17)9(2)8-11(10(3)14)12(15)6-5-7-16(18)19/h5-6H,2-4,7-8H2,1H3/b6-5-,12-11+ |
| InChIKey | VSBQIEOTIIISHO-OXHHXQHLSA-N |
| XLogP | 3.04 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate?
The IUPAC name of ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate (CID 129143870) is ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate.
What is the SMILES notation for ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate?
The canonical SMILES for ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate is C=C(C/C(C(=C)F)=C(F)/C=C\C[N+](=O)[O-])C(=O)OCC.
What is the InChIKey of ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate?
The InChIKey is VSBQIEOTIIISHO-OXHHXQHLSA-N. The full InChI is InChI=1S/C13H15F2NO4/c1-4-20-13(17)9(2)8-11(10(3)14)12(15)6-5-7-16(18)19/h5-6H,2-4,7-8H2,1H3/b6-5-,12-11+.
What are the key properties of ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate?
ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate has a molecular weight of 287.26 g/mol, XLogP of 3.04, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4E,6Z)-5-fluoro-4-(1-fluoroethenyl)-2-methylidene-8-nitroocta-4,6-dienoate is sourced from PubChem (CID 129143870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).