C24H23N3O2 — CID 129143878
1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-4-phenylmethoxypyridin-2-one (PubChem CID 129143878) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 129143878 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-4-phenylmethoxypyridin-2-one |
| SMILES | CN1CCc2c([nH]c3ccc(-n4ccc(OCc5ccccc5)cc4=O)cc23)C1 |
| InChI | InChI=1S/C24H23N3O2/c1-26-11-10-20-21-13-18(7-8-22(21)25-23(20)15-26)27-12-9-19(14-24(27)28)29-16-17-5-3-2-4-6-17/h2-9,12-14,25H,10-11,15-16H2,1H3 |
| InChIKey | URYLXSMTLLJPBR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|