About 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane]
7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] (PubChem CID 129143924) has the molecular formula C12H13IO
and a molecular weight of 300.14 g/mol. Its IUPAC name is 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane].
Molecular Properties
| Compound Name | 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] |
| PubChem CID | 129143924 |
| Molecular Formula | C12H13IO |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] |
| SMILES | Cc1ccc(I)c2c1C1(CCO1)CC2 |
| InChI | InChI=1S/C12H13IO/c1-8-2-3-10(13)9-4-5-12(11(8)9)6-7-14-12/h2-3H,4-7H2,1H3 |
| InChIKey | LGUHZYJIKMSUBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane]?
The IUPAC name of 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] (CID 129143924) is 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane].
What is the SMILES notation for 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane]?
The canonical SMILES for 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] is Cc1ccc(I)c2c1C1(CCO1)CC2.
What is the InChIKey of 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane]?
The InChIKey is LGUHZYJIKMSUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IO/c1-8-2-3-10(13)9-4-5-12(11(8)9)6-7-14-12/h2-3H,4-7H2,1H3.
What are the key properties of 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane]?
7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] has a molecular weight of 300.14 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-4-methylspiro[1,2-dihydroindene-3,2'-oxetane] is sourced from PubChem (CID 129143924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).