About 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione
2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione (PubChem CID 129144079) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione.
Molecular Properties
| Compound Name | 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione |
| PubChem CID | 129144079 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione |
| SMILES | CCC(C)N1C(=O)C=NC2C(=O)NC(N)=NC21 |
| InChI | InChI=1S/C10H15N5O2/c1-3-5(2)15-6(16)4-12-7-8(15)13-10(11)14-9(7)17/h4-5,7-8H,3H2,1-2H3,(H3,11,13,14,17) |
| InChIKey | ARFJAXKEJKLUOY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione?
The IUPAC name of 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione (CID 129144079) is 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione.
What is the SMILES notation for 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione?
The canonical SMILES for 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione is CCC(C)N1C(=O)C=NC2C(=O)NC(N)=NC21.
What is the InChIKey of 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione?
The InChIKey is ARFJAXKEJKLUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-3-5(2)15-6(16)4-12-7-8(15)13-10(11)14-9(7)17/h4-5,7-8H,3H2,1-2H3,(H3,11,13,14,17).
What are the key properties of 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione?
2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione has a molecular weight of 237.26 g/mol, XLogP of -1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-butan-2-yl-4a,8a-dihydro-3H-pteridine-4,7-dione is sourced from PubChem (CID 129144079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).