C19H37N3 — CID 129144345
(2S)-N-[(2S,3S)-6-cyclopentyl-3,4-dimethylhexan-2-yl]-N'-methylpyrrolidine-2-carboximidamide (PubChem CID 129144345) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is (2S)-N-[(2S,3S)-6-cyclopentyl-3,4-dimethylhexan-2-yl]-N'-methylpyrrolidine-2-carboximidamide.
| Compound Name | (2S)-N-[(2S,3S)-6-cyclopentyl-3,4-dimethylhexan-2-yl]-N'-methylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 129144345 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | (2S)-N-[(2S,3S)-6-cyclopentyl-3,4-dimethylhexan-2-yl]-N'-methylpyrrolidine-2-carboximidamide |
| SMILES | C/N=C(\N[C@@H](C)[C@@H](C)C(C)CCC1CCCC1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C19H37N3/c1-14(11-12-17-8-5-6-9-17)15(2)16(3)22-19(20-4)18-10-7-13-21-18/h14-18,21H,5-13H2,1-4H3,(H,20,22)/t14?,15-,16-,18-/m0/s1 |
| InChIKey | OUTDNXQGBJRMQX-OVQIEAOZSA-N |
| XLogP | 3.99 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|