About (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one
(2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one (PubChem CID 129144463) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one |
| PubChem CID | 129144463 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(N/C=C2\C(=O)CC(C)(C)CC2O)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-11-4-6-12(7-5-11)17-10-13-14(18)8-16(2,3)9-15(13)19/h4-7,10,14,17-18H,8-9H2,1-3H3/b13-10- |
| InChIKey | ZVXYVGPHVPBFFM-RAXLEYEMSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one?
The IUPAC name of (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one (CID 129144463) is (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one.
What is the SMILES notation for (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one?
The canonical SMILES for (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one is Cc1ccc(N/C=C2\C(=O)CC(C)(C)CC2O)cc1.
What is the InChIKey of (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one?
The InChIKey is ZVXYVGPHVPBFFM-RAXLEYEMSA-N. The full InChI is InChI=1S/C16H21NO2/c1-11-4-6-12(7-5-11)17-10-13-14(18)8-16(2,3)9-15(13)19/h4-7,10,14,17-18H,8-9H2,1-3H3/b13-10-.
What are the key properties of (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one?
(2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one has a molecular weight of 259.35 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-hydroxy-5,5-dimethyl-2-[(4-methylanilino)methylidene]cyclohexan-1-one is sourced from PubChem (CID 129144463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).