C11H19N3O2 — CID 129144583
1-amino-5-(3-methylhexan-3-yl)pyrimidine-2,4-dione (PubChem CID 129144583) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-amino-5-(3-methylhexan-3-yl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-5-(3-methylhexan-3-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129144583 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-amino-5-(3-methylhexan-3-yl)pyrimidine-2,4-dione |
| SMILES | CCCC(C)(CC)c1cn(N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19N3O2/c1-4-6-11(3,5-2)8-7-14(12)10(16)13-9(8)15/h7H,4-6,12H2,1-3H3,(H,13,15,16) |
| InChIKey | PQCIFPDJEYPLSL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |