C25H32N6O2S — CID 129144590
1,3-diamino-1-[3-cyclopropyl-2-[[4-(1,4-dimethyl-5-methylsulfanylpyrazol-3-yl)-2-methylphenoxy]methyl]phenyl]-3-methylurea (PubChem CID 129144590) has the molecular formula C25H32N6O2S and a molecular weight of 480.64 g/mol. Its IUPAC name is 1,3-diamino-1-[3-cyclopropyl-2-[[4-(1,4-dimethyl-5-methylsulfanylpyrazol-3-yl)-2-methylphenoxy]methyl]phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[3-cyclopropyl-2-[[4-(1,4-dimethyl-5-methylsulfanylpyrazol-3-yl)-2-methylphenoxy]methyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 129144590 |
| Molecular Formula | C25H32N6O2S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1,3-diamino-1-[3-cyclopropyl-2-[[4-(1,4-dimethyl-5-methylsulfanylpyrazol-3-yl)-2-methylphenoxy]methyl]phenyl]-3-methylurea |
| SMILES | CSc1c(C)c(-c2ccc(OCc3c(C4CC4)cccc3N(N)C(=O)N(C)N)c(C)c2)nn1C |
| InChI | InChI=1S/C25H32N6O2S/c1-15-13-18(23-16(2)24(34-5)30(4)28-23)11-12-22(15)33-14-20-19(17-9-10-17)7-6-8-21(20)31(27)25(32)29(3)26/h6-8,11-13,17H,9-10,14,26-27H2,1-5H3 |
| InChIKey | XVPIOUJPGOMEQM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|