C10H11NO2 — CID 129144655
N-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide (PubChem CID 129144655) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is N-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide.
| Compound Name | N-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 129144655 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | N-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C=C(C)C(=O)C=C1C |
| InChI | InChI=1S/C10H11NO2/c1-6-5-10(13)7(2)4-9(6)11-8(3)12/h4-5H,1-3H3/b11-9+ |
| InChIKey | ICWGHPYFTZCLBJ-PKNBQFBNSA-N |
| XLogP | 1.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|