About [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite
[3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite (PubChem CID 129144697) has the molecular formula C18H15BrINO2S
and a molecular weight of 516.20 g/mol. Its IUPAC name is [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite.
Molecular Properties
| Compound Name | [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite |
| PubChem CID | 129144697 |
| Molecular Formula | C18H15BrINO2S |
| Molecular Weight | 516.20 g/mol |
| Exact Mass | 514.91 |
| IUPAC Name | [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite |
| SMILES | Cc1cc(NSI)c(C)c(-c2c(O)ccc3cc(Br)ccc23)c1O |
| InChI | InChI=1S/C18H15BrINO2S/c1-9-7-14(21-24-20)10(2)16(18(9)23)17-13-5-4-12(19)8-11(13)3-6-15(17)22/h3-8,21-23H,1-2H3 |
| InChIKey | AXJCWRGLXAJKIV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.20 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite?
The IUPAC name of [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite (CID 129144697) is [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite.
What is the SMILES notation for [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite?
The canonical SMILES for [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite is Cc1cc(NSI)c(C)c(-c2c(O)ccc3cc(Br)ccc23)c1O.
What is the InChIKey of [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite?
The InChIKey is AXJCWRGLXAJKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrINO2S/c1-9-7-14(21-24-20)10(2)16(18(9)23)17-13-5-4-12(19)8-11(13)3-6-15(17)22/h3-8,21-23H,1-2H3.
What are the key properties of [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite?
[3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite has a molecular weight of 516.20 g/mol, XLogP of 6.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-bromo-2-hydroxynaphthalen-1-yl)-4-hydroxy-2,5-dimethylanilino] thiohypoiodite is sourced from PubChem (CID 129144697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).