About 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine
3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine (PubChem CID 129144726) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine.
Molecular Properties
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine |
| PubChem CID | 129144726 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine |
| SMILES | C=C(CC1C=CC=CC1)NC(C)C |
| InChI | InChI=1S/C12H19N/c1-10(2)13-11(3)9-12-7-5-4-6-8-12/h4-7,10,12-13H,3,8-9H2,1-2H3 |
| InChIKey | OPCLYUKICGGPPA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine?
The IUPAC name of 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine (CID 129144726) is 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine.
What is the SMILES notation for 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine?
The canonical SMILES for 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine is C=C(CC1C=CC=CC1)NC(C)C.
What is the InChIKey of 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine?
The InChIKey is OPCLYUKICGGPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-10(2)13-11(3)9-12-7-5-4-6-8-12/h4-7,10,12-13H,3,8-9H2,1-2H3.
What are the key properties of 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine?
3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine has a molecular weight of 177.29 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-2,4-dien-1-yl-N-propan-2-ylprop-1-en-2-amine is sourced from PubChem (CID 129144726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).