C12H19N — CID 129144732
3,4-dimethyl-7-methylidene-2-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydroazepine (PubChem CID 129144732) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3,4-dimethyl-7-methylidene-2-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydroazepine.
| Compound Name | 3,4-dimethyl-7-methylidene-2-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydroazepine |
|---|---|
| PubChem CID | 129144732 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3,4-dimethyl-7-methylidene-2-[(Z)-prop-1-enyl]-1,2,3,4-tetrahydroazepine |
| SMILES | C=C1C=CC(C)C(C)C(/C=C\C)N1 |
| InChI | InChI=1S/C12H19N/c1-5-6-12-11(4)9(2)7-8-10(3)13-12/h5-9,11-13H,3H2,1-2,4H3/b6-5- |
| InChIKey | UEUGQSKIGQAMDS-WAYWQWQTSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|